CAS 784129-18-6 appears in our catalog under these names: 1-(3,4,5-Trifluorophenyl)ethan-1-amine, 95%, 1-(3,4,5-Trifluorophenyl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3,4,5-trifluorophenyl)ethanamine (CAS 784129-18-6) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 1-(3,4,5-trifluorophenyl)ethanamine. InChIKey: QWYPAKQHZBBLFE-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 1-(3,4,5-trifluorophenyl)ethanamine |
| InChIKey | QWYPAKQHZBBLFE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C(=C1)F)F)F)N |
Computed by PubChem (NCBI)