Products 78583-87-6
CAS 78583-87-6 appears in our catalog under these names: 3-(4-Bromophenyl)-3-chloroacrylonitrile, 95%, 3-(4-Bromophenyl)-3-chloroacrylonitrile. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
3-(4-bromophenyl)-3-chloroprop-2-enenitrile (CAS 78583-87-6) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 3-(4-bromophenyl)-3-chloroprop-2-enenitrile. InChIKey: LDXSSEKZKTYYOQ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 3-(4-bromophenyl)-3-chloroprop-2-enenitrile |
| InChIKey | LDXSSEKZKTYYOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=CC#N)Cl)Br |
Computed by PubChem (NCBI)