CAS 78584-08-4 appears in our catalog under these names: 4,7-Dimethylbenzo[d]thiazol-2-amine 95%, 2-Amino-4,7-dimethylbenzothiazole, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 500mg.
4,7-dimethyl-1,3-benzothiazol-2-amine (CAS 78584-08-4) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: 4,7-dimethyl-1,3-benzothiazol-2-amine. InChIKey: FHUBACQXVCSGNR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | FHUBACQXVCSGNR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C)SC(=N2)N |
Computed by PubChem (NCBI)