Products 786690-18-4
CAS 786690-18-4 is the registry number for 2-bromo-4-(1,3-dioxolan-2-yl)-N,N-dimethylaniline, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-4-(1,3-dioxolan-2-yl)-N,N-dimethylaniline (CAS 786690-18-4) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-bromo-4-(1,3-dioxolan-2-yl)-N,N-dimethylaniline. InChIKey: BJDVGFOYCFRKFJ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-bromo-4-(1,3-dioxolan-2-yl)-N,N-dimethylaniline |
| InChIKey | BJDVGFOYCFRKFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C2OCCO2)Br |
Computed by PubChem (NCBI)