Products 78738-97-3
CAS 78738-97-3 is the registry number for LY-99335. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3R,4R)-1,3,4-trimethylpiperidin-4-yl]phenol;hydrochloride (CAS 78738-97-3) is a chemical compound with the molecular formula C14H22ClNO and a molecular weight of 255.78 g/mol. IUPAC name: 3-[(3R,4R)-1,3,4-trimethylpiperidin-4-yl]phenol;hydrochloride. InChIKey: SPNIBSZVXCWVMO-YECZQDJWSA-N.
| Molecular formula | C14H22ClNO |
|---|---|
| Molecular weight | 255.78 g/mol |
| IUPAC name | 3-[(3R,4R)-1,3,4-trimethylpiperidin-4-yl]phenol;hydrochloride |
| InChIKey | SPNIBSZVXCWVMO-YECZQDJWSA-N |
| SMILES | C[C@H]1CN(CC[C@@]1(C)C2=CC(=CC=C2)O)C.Cl |
Computed by PubChem (NCBI)