Products 78759-45-2
CAS 78759-45-2 is the registry number for 8-Diazomethyl quinoline. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-(diazomethyl)quinoline (CAS 78759-45-2) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 8-(diazomethyl)quinoline. InChIKey: YIYQYHXMBRAANE-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 8-(diazomethyl)quinoline |
| InChIKey | YIYQYHXMBRAANE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C=[N+]=[N-])N=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
8-(diazomethyl) quinoline, orb3181713