CAS 78832-61-8 appears in our catalog under these names: 2-Naphthol-d8, >95% (HPLC), 2-Naphthol-d8, 98 atom % D, min 98% Chemical Purity, 2-Naphthol-d8. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 10 mg, 50 mg, 5 mg.
1,2,3,4,5,6,8-heptadeuterio-7-deuteriooxynaphthalene (CAS 78832-61-8) is a chemical compound with the molecular formula C10H8O and a molecular weight of 152.22 g/mol. IUPAC name: 1,2,3,4,5,6,8-heptadeuterio-7-deuteriooxynaphthalene. InChIKey: JWAZRIHNYRIHIV-GZORGGLCSA-N.
| Molecular formula | C10H8O |
|---|---|
| Molecular weight | 152.22 g/mol |
| IUPAC name | 1,2,3,4,5,6,8-heptadeuterio-7-deuteriooxynaphthalene |
| InChIKey | JWAZRIHNYRIHIV-GZORGGLCSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])O[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)