Products 207569-03-7
CAS 207569-03-7 appears in our catalog under these names: Duloxetine EP Impurity D-d8 (1-Naphthol-d8), 1-Naphthol-d8, 98 atom % D, min 98% Chemical Purity, 1-Naphthol-d8. Offered by: Chemat Brand, CDN, MedChemExpress. Available pack sizes: on request, 0,5g, 0,25g, 1 mg.
1,2,3,4,5,6,7-heptadeuterio-8-deuteriooxynaphthalene (CAS 207569-03-7) is a chemical compound with the molecular formula C10H8O and a molecular weight of 152.22 g/mol. IUPAC name: 1,2,3,4,5,6,7-heptadeuterio-8-deuteriooxynaphthalene. InChIKey: KJCVRFUGPWSIIH-GZORGGLCSA-N.
| Molecular formula | C10H8O |
|---|---|
| Molecular weight | 152.22 g/mol |
| IUPAC name | 1,2,3,4,5,6,7-heptadeuterio-8-deuteriooxynaphthalene |
| InChIKey | KJCVRFUGPWSIIH-GZORGGLCSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)