CAS 788824-64-6 appears in our catalog under these names: Thyroxamine Impurity 1 HCl, 3-Iodothyronamine Hydrochloride, >95% (HPLC), 3-Iodothyronamine (hydrochloride), 3–Iodothyronamine (hydrochloride), 3-Iodothyronamine Hydrochloride. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 500ug, 500μg, 25mg, 10mg.
4-[4-(2-aminoethyl)-2-iodophenoxy]phenol;hydrochloride (CAS 788824-64-6) is a chemical compound with the molecular formula C14H15ClINO2 and a molecular weight of 391.63 g/mol. IUPAC name: 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol;hydrochloride. InChIKey: RVKVVMXTPQCCIX-UHFFFAOYSA-N.
| Molecular formula | C14H15ClINO2 |
|---|---|
| Molecular weight | 391.63 g/mol |
| IUPAC name | 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol;hydrochloride |
| InChIKey | RVKVVMXTPQCCIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2)CCN)I.Cl |
Computed by PubChem (NCBI)