CAS 884320-54-1 appears in our catalog under these names: 3–Iodothyronamine–d4 hydrochloride, 3-Iodothyronamine-d4 Hydrochloride, 3-Iodothyronamine-d4 (hydrochloride), 99.26%. Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 25mg, 500μg, 5mg, 10mg, 50mg, 1 mg, 500 μg.
4-[4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-iodophenoxy]phenol;hydrochloride (CAS 884320-54-1) is a chemical compound with the molecular formula C14H15ClINO2 and a molecular weight of 395.65 g/mol. IUPAC name: 4-[4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-iodophenoxy]phenol;hydrochloride. InChIKey: RVKVVMXTPQCCIX-UVSTZUAESA-N.
| Molecular formula | C14H15ClINO2 |
|---|---|
| Molecular weight | 395.65 g/mol |
| IUPAC name | 4-[4-(2-amino-1,1,2,2-tetradeuterioethyl)-2-iodophenoxy]phenol;hydrochloride |
| InChIKey | RVKVVMXTPQCCIX-UVSTZUAESA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)OC2=CC=C(C=C2)O)I)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)