CAS 78920-21-5 appears in our catalog under these names: 5-Phenylpyridazin-3(2H)-one, 97%, 5-Phenyl-2,3-dihydropyridazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
4-phenyl-1H-pyridazin-6-one (CAS 78920-21-5) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 4-phenyl-1H-pyridazin-6-one. InChIKey: LXUBSTAJRVVVTJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-phenyl-1H-pyridazin-6-one |
| InChIKey | LXUBSTAJRVVVTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NN=C2 |
Computed by PubChem (NCBI)