Products 78930-82-2
CAS 78930-82-2 appears in our catalog under these names: Methanesulfonic acid, trifluoro-, 4-(4-chlorobenzoyl)phenyl ester, 98%, 4-(4-Chlorobenzoyl)phenyl trifluoromethanesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[4-(4-chlorobenzoyl)phenyl] trifluoromethanesulfonate (CAS 78930-82-2) is a chemical compound with the molecular formula C14H8ClF3O4S and a molecular weight of 364.7 g/mol. IUPAC name: [4-(4-chlorobenzoyl)phenyl] trifluoromethanesulfonate. InChIKey: IFPRXRNLHSINMU-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3O4S |
|---|---|
| Molecular weight | 364.7 g/mol |
| IUPAC name | [4-(4-chlorobenzoyl)phenyl] trifluoromethanesulfonate |
| InChIKey | IFPRXRNLHSINMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)