Products 78963-60-7

CAS 78963-60-7 is the registry number for Tebipenem Pivoxil Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate (CAS 78963-60-7) is a chemical compound with the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. IUPAC name: [(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate. InChIKey: GWHDKFODLYVMQG-PTOFAABTSA-N.

Identity
Molecular formulaC13H25NO4Si
Molecular weight287.43 g/mol
IUPAC name[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate
InChIKeyGWHDKFODLYVMQG-PTOFAABTSA-N
SMILESC[C@@H]([C@@H]1[C@H](NC1=O)OC(=O)C)O[Si](C)(C)C(C)(C)C

Computed by PubChem (NCBI)