Products 81275-02-7
CAS 81275-02-7 appears in our catalog under these names: Imipenem Impurity 8, Tebipenem Pivoxil Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate (CAS 81275-02-7) is a chemical compound with the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. IUPAC name: [(2S,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate. InChIKey: GWHDKFODLYVMQG-XRNSZHNASA-N.
| Molecular formula | C13H25NO4Si |
|---|---|
| Molecular weight | 287.43 g/mol |
| IUPAC name | [(2S,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] acetate |
| InChIKey | GWHDKFODLYVMQG-XRNSZHNASA-N |
| SMILES | C[C@@H]([C@H]1[C@@H](NC1=O)OC(=O)C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)