Products 79025-82-4
CAS 79025-82-4 appears in our catalog under these names: 2–Amino–5–chloro–4–methoxybenzoic acid, 2-Amino-5-chloro-4-methoxy-benzoic acid, 2-Amino-5-chloro-4-methoxybenzoic acid 97%, 2-Amino-5-chloro-4-methoxybenzoic acid, 98%, 2-Amino-5-chloro-4-methoxybenzoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 2.5g, 10g.
2-amino-5-chloro-4-methoxybenzoic acid (CAS 79025-82-4) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 2-amino-5-chloro-4-methoxybenzoic acid. InChIKey: VJLREPGGNOEDCE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-amino-5-chloro-4-methoxybenzoic acid |
| InChIKey | VJLREPGGNOEDCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C(=O)O)Cl |
Computed by PubChem (NCBI)