CAS 79050-49-0 appears in our catalog under these names: 4,5-Dimethyl-1,3-benzothiazol-2-amine, 98%, 2-Amino-4,5-dimethylbenzothiazole, 2–Benzothiazolamine,4,5–dimethyl–(9CI). Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
4,5-dimethyl-1,3-benzothiazol-2-amine (CAS 79050-49-0) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: 4,5-dimethyl-1,3-benzothiazol-2-amine. InChIKey: ZAJVZJPXCSIEQP-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | 4,5-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | ZAJVZJPXCSIEQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)SC(=N2)N)C |
Computed by PubChem (NCBI)