Products 79055-11-1
CAS 79055-11-1 appears in our catalog under these names: meso–Hannokinol, meso-Hannokinol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(3R,5S)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol (CAS 79055-11-1) is a chemical compound with the molecular formula C19H24O4 and a molecular weight of 316.4 g/mol. IUPAC name: (3R,5S)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol. InChIKey: GZVIQGVWSNEONZ-KDURUIRLSA-N.
| Molecular formula | C19H24O4 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (3R,5S)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol |
| InChIKey | GZVIQGVWSNEONZ-KDURUIRLSA-N |
| SMILES | C1=CC(=CC=C1CC[C@H](C[C@H](CCC2=CC=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
meso-Hannokinol, orb1984146