Products 924843-90-3
CAS 924843-90-3 appears in our catalog under these names: 3-(3,4-Dimethoxyphenyl)adamantane-1-carboxylic acid, 95%, 3-(3,4-Dimethoxyphenyl)adamantane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(3,4-dimethoxyphenyl)adamantane-1-carboxylic acid (CAS 924843-90-3) is a chemical compound with the molecular formula C19H24O4 and a molecular weight of 316.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)adamantane-1-carboxylic acid. InChIKey: JWSIHEWTCURFRH-UHFFFAOYSA-N.
| Molecular formula | C19H24O4 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)adamantane-1-carboxylic acid |
| InChIKey | JWSIHEWTCURFRH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C23CC4CC(C2)CC(C4)(C3)C(=O)O)OC |
Computed by PubChem (NCBI)