Products 790633-59-9
CAS 790633-59-9 appears in our catalog under these names: SCH-50910, Sch 50910. Offered by: Biosynth, MedChemExpress. Available pack sizes: 500mg, Get quote.
2-[(2R)-5,5-dimethylmorpholin-2-yl]acetic acid (CAS 790633-59-9) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-[(2R)-5,5-dimethylmorpholin-2-yl]acetic acid. InChIKey: SEYCKMQSPUVYEF-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-[(2R)-5,5-dimethylmorpholin-2-yl]acetic acid |
| InChIKey | SEYCKMQSPUVYEF-ZCFIWIBFSA-N |
| SMILES | CC1(CO[C@@H](CN1)CC(=O)O)C |
Computed by PubChem (NCBI)