Products 79094-22-7
CAS 79094-22-7 is the registry number for 4-(2-[(Methylsulfonyl)amino]ethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
4-[2-(methanesulfonamido)ethyl]benzoic acid (CAS 79094-22-7) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 4-[2-(methanesulfonamido)ethyl]benzoic acid. InChIKey: WYIOCTBMAODUCE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 4-[2-(methanesulfonamido)ethyl]benzoic acid |
| InChIKey | WYIOCTBMAODUCE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2-methanesulfonamidoethyl)benzoic Acid, 4-(2-[(Methylsulfonyl)amino]ethyl)benzoic acid, 4-[2-[(Methylsulfonyl)amino]ethyl]benzoic acid, 4-(2-((Methylsulfonyl)amino)ethyl)benzoic acid, 4-[2-(methanesulfonamido)ethyl]benzoic acid, 4-(2-methanesulfonamidoethyl)benzoicAcid, 4-{2-[(Methanesulfonyl)amino]ethyl}benzoic acid