Products 791601-07-5
CAS 791601-07-5 appears in our catalog under these names: 3-(4-Bromo-3-chlorophenyl)propanoic acid, 3-(4-BROMO-3-CHLORO-PHENYL)-PROPIONIC ACID, 97%, 97%, 3-(4-Bromo-3-chlorophenyl)propanoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg, 5g.
3-(4-bromo-3-chlorophenyl)propanoic acid (CAS 791601-07-5) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 3-(4-bromo-3-chlorophenyl)propanoic acid. InChIKey: KVTFMKUQYPWUHK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 3-(4-bromo-3-chlorophenyl)propanoic acid |
| InChIKey | KVTFMKUQYPWUHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)Cl)Br |
Computed by PubChem (NCBI)