CAS 79263-00-6 appears in our catalog under these names: 2–Amino–3,5–dimethoxybenzoic acid, 2-Amino-3,5-dimethoxybenzoic acid, 2-Amino-3,5-dimethoxybenzoic acid 95%, 2-Amino-3,5-dimethoxybenzoic acid, 95%, 95%, 2-Amino-3,5-dimethoxybenzoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
2-amino-3,5-dimethoxybenzoic acid (CAS 79263-00-6) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-3,5-dimethoxybenzoic acid. InChIKey: OACFQDBLYWKDMK-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-3,5-dimethoxybenzoic acid |
| InChIKey | OACFQDBLYWKDMK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)N)C(=O)O |
Computed by PubChem (NCBI)