Products 79422-72-3
CAS 79422-72-3 is the registry number for 5-(3-Bromophenyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(3-bromophenyl)imidazolidine-2,4-dione (CAS 79422-72-3) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 5-(3-bromophenyl)imidazolidine-2,4-dione. InChIKey: CGHQCQUIFVSVMG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 5-(3-bromophenyl)imidazolidine-2,4-dione |
| InChIKey | CGHQCQUIFVSVMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)