CAS 794507-89-4 is the registry number for (R)-7-Bromo-1,2,3,4-tetrahydro-naphthalen-1-ylamine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(1R)-7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 794507-89-4) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: (1R)-7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: PHUSWQSCHYYQQF-SNVBAGLBSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | (1R)-7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | PHUSWQSCHYYQQF-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)