CAS 794584-37-5 appears in our catalog under these names: 3-(N-Benzyl2,6-dichlorobenzenesulfonamido)propanoic acid, 95%, 3-(N-Benzyl2,6-dichlorobenzenesulfonamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid (CAS 794584-37-5) is a chemical compound with the molecular formula C16H15Cl2NO4S and a molecular weight of 388.3 g/mol. IUPAC name: 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid. InChIKey: VSRSQRYILCZIFO-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO4S |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | VSRSQRYILCZIFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CCC(=O)O)S(=O)(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)