CAS 884987-11-5 is the registry number for Methyl n-(2,3-dichlorophenyl)-n-[(4-methylphenyl)sulfonyl]glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate (CAS 884987-11-5) is a chemical compound with the molecular formula C16H15Cl2NO4S and a molecular weight of 388.3 g/mol. IUPAC name: methyl 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate. InChIKey: RGMONGONLLAPOG-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO4S |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | methyl 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate |
| InChIKey | RGMONGONLLAPOG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)OC)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)