CAS 858248-39-2 appears in our catalog under these names: 2,5-Dimethylfuran-3-sulfonamide, 95%, 2,5-Dimethylfuran-3-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,5-dimethylfuran-3-sulfonamide (CAS 858248-39-2) is a chemical compound with the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. IUPAC name: 2,5-dimethylfuran-3-sulfonamide. InChIKey: SGKVBVKVYUQAGA-UHFFFAOYSA-N.
| Molecular formula | C6H9NO3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 2,5-dimethylfuran-3-sulfonamide |
| InChIKey | SGKVBVKVYUQAGA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)S(=O)(=O)N |
Computed by PubChem (NCBI)