CAS 795282-28-9 appears in our catalog under these names: Vernakalant Impurity 4 ((3S,1'S,2'R)-Isomer), Vernakalant Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-1-[(1S,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol (CAS 795282-28-9) is a chemical compound with the molecular formula C20H31NO4 and a molecular weight of 349.5 g/mol. IUPAC name: (3S)-1-[(1S,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol. InChIKey: VBHQKCBVWWUUKN-OKZBNKHCSA-N.
| Molecular formula | C20H31NO4 |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | (3S)-1-[(1S,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol |
| InChIKey | VBHQKCBVWWUUKN-OKZBNKHCSA-N |
| SMILES | COC1=C(C=C(C=C1)CCO[C@@H]2CCCC[C@@H]2N3CC[C@@H](C3)O)OC |
Computed by PubChem (NCBI)