Products 795282-30-3

CAS 795282-30-3 appears in our catalog under these names: Vernakalant Impurity 3 ((3S,1'R,2'S)-Isomer), Vernakalant Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol (CAS 795282-30-3) is a chemical compound with the molecular formula C20H31NO4 and a molecular weight of 349.5 g/mol. IUPAC name: (3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol. InChIKey: VBHQKCBVWWUUKN-KSZLIROESA-N.

Identity
Molecular formulaC20H31NO4
Molecular weight349.5 g/mol
IUPAC name(3S)-1-[(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol
InChIKeyVBHQKCBVWWUUKN-KSZLIROESA-N
SMILESCOC1=C(C=C(C=C1)CCO[C@H]2CCCC[C@H]2N3CC[C@@H](C3)O)OC

Computed by PubChem (NCBI)