CAS 79556-69-7 appears in our catalog under these names: 4-Amino-3-nitrobenzylamine hydrochloride, 95%, 4-Amino-3-nitrobenzylamine hydrochloride, 4-(Aminomethyl)-2-nitroaniline, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 500mg, 1000mg, 2000mg, 100mg.
4-(aminomethyl)-2-nitroaniline (CAS 79556-69-7) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: 4-(aminomethyl)-2-nitroaniline. InChIKey: VYPGEDMAENMAAQ-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 4-(aminomethyl)-2-nitroaniline |
| InChIKey | VYPGEDMAENMAAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)[N+](=O)[O-])N |
Computed by PubChem (NCBI)