CAS 796079-89-5 is the registry number for 1-(5,6,7,8-Tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxylic acid (CAS 796079-89-5) is a chemical compound with the molecular formula C16H21NO4S and a molecular weight of 323.4 g/mol. IUPAC name: 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxylic acid. InChIKey: ITCFXJKCRFRSOG-UHFFFAOYSA-N.
| Molecular formula | C16H21NO4S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxylic acid |
| InChIKey | ITCFXJKCRFRSOG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)N3CCC(CC3)C(=O)O |
Computed by PubChem (NCBI)