CAS 83623-88-5 is the registry number for (2S,4S)-1-(tert-Butoxycarbonyl)-4-(phenylthio)pyrrolidine-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid (CAS 83623-88-5) is a chemical compound with the molecular formula C16H21NO4S and a molecular weight of 323.4 g/mol. IUPAC name: (2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid. InChIKey: CFOPWPUEKDDDFO-STQMWFEESA-N.
| Molecular formula | C16H21NO4S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| InChIKey | CFOPWPUEKDDDFO-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)