CAS 796123-56-3 is the registry number for WAY-640169-10mMinDMSO,,, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg.
5-methyl-3-phenyl-N-[4-(tetrazol-1-yl)phenyl]-1,2-oxazole-4-carboxamide (CAS 796123-56-3) is a chemical compound with the molecular formula C18H14N6O2 and a molecular weight of 346.3 g/mol. IUPAC name: 5-methyl-3-phenyl-N-[4-(tetrazol-1-yl)phenyl]-1,2-oxazole-4-carboxamide. InChIKey: CYYSHNTUESRWKP-UHFFFAOYSA-N.
| Molecular formula | C18H14N6O2 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 5-methyl-3-phenyl-N-[4-(tetrazol-1-yl)phenyl]-1,2-oxazole-4-carboxamide |
| InChIKey | CYYSHNTUESRWKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)N4C=NN=N4 |
Computed by PubChem (NCBI)