CAS 79617-90-6 appears in our catalog under these names: Sertraline EP Impurity C HCl (1R,4R-Isomer), Sertraline Impurity 14((1R,4R)-Sertraline 4-Chlorophenyl Impurity HCl). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1R,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 79617-90-6) is a chemical compound with the molecular formula C17H19Cl2N and a molecular weight of 308.2 g/mol. IUPAC name: (1R,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: QTILPEMKUQBCMU-SATBOSKTSA-N.
| Molecular formula | C17H19Cl2N |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | (1R,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | QTILPEMKUQBCMU-SATBOSKTSA-N |
| SMILES | CN[C@@H]1CC[C@@H](C2=CC=CC=C12)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)