CAS 79896-35-8 is the registry number for rac-trans-3-Dechloro Sertraline Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(1S,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 79896-35-8) is a chemical compound with the molecular formula C17H19Cl2N and a molecular weight of 308.2 g/mol. IUPAC name: (1S,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: QTILPEMKUQBCMU-CVLQQERVSA-N.
| Molecular formula | C17H19Cl2N |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | (1S,4R)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | QTILPEMKUQBCMU-CVLQQERVSA-N |
| SMILES | CN[C@H]1CC[C@@H](C2=CC=CC=C12)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)