CAS 79559-98-1 appears in our catalog under these names: Sertraline EP Impurity C, Sertraline EP Impurity C HCl, Sertraline Impurity 3(Sertraline EP Impurity C), rac-cis-3-Dechloro Sertraline Hydrochloride, >95% (HPLC), (1RS,4RS)-4-(4-Chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(1S,4S)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 79559-98-1) is a chemical compound with the molecular formula C17H19Cl2N and a molecular weight of 308.2 g/mol. IUPAC name: (1S,4S)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: QTILPEMKUQBCMU-RVXRQPKJSA-N.
| Molecular formula | C17H19Cl2N |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | (1S,4S)-4-(4-chlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | QTILPEMKUQBCMU-RVXRQPKJSA-N |
| SMILES | CN[C@H]1CC[C@H](C2=CC=CC=C12)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)