CAS 79672-26-7 appears in our catalog under these names: Methyl 2-(dimethylsulfamoyl)benzoate, 95%, Methyl 2-(dimethylsulfamoyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 2-(dimethylsulfamoyl)benzoate (CAS 79672-26-7) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: methyl 2-(dimethylsulfamoyl)benzoate. InChIKey: KJHNRJLTKYMHHM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | methyl 2-(dimethylsulfamoyl)benzoate |
| InChIKey | KJHNRJLTKYMHHM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1C(=O)OC |
Computed by PubChem (NCBI)