Products 797756-92-4

CAS 797756-92-4 is the registry number for 3-Hydroxy-2-(4-bromophenyl)-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-bromophenyl)-3-hydroxypropanoate (CAS 797756-92-4) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: ethyl 2-(4-bromophenyl)-3-hydroxypropanoate. InChIKey: PMMRZKHXEAWVIL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO3
Molecular weight273.12 g/mol
IUPAC nameethyl 2-(4-bromophenyl)-3-hydroxypropanoate
InChIKeyPMMRZKHXEAWVIL-UHFFFAOYSA-N
SMILESCCOC(=O)C(CO)C1=CC=C(C=C1)Br

Computed by PubChem (NCBI)