Products 797775-86-1
CAS 797775-86-1 is the registry number for (3-Isobutyryl-indol-1-yl)-acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-[3-(2-methylpropanoyl)indol-1-yl]acetic acid (CAS 797775-86-1) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 2-[3-(2-methylpropanoyl)indol-1-yl]acetic acid. InChIKey: LRYCYXQTQVFFNH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 2-[3-(2-methylpropanoyl)indol-1-yl]acetic acid |
| InChIKey | LRYCYXQTQVFFNH-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CN(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)