Products 79831-86-0
CAS 79831-86-0 is the registry number for Methyl 3-(benzyloxy)-4,5-dihydroxybenzoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3,4-dihydroxy-5-phenylmethoxybenzoate (CAS 79831-86-0) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: methyl 3,4-dihydroxy-5-phenylmethoxybenzoate. InChIKey: PUIWZZWMNAHWJG-UHFFFAOYSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | methyl 3,4-dihydroxy-5-phenylmethoxybenzoate |
| InChIKey | PUIWZZWMNAHWJG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Benzyloxy-4,5-dihydroxy-benzoic acid methyl ester, methyl 3-(benzyloxy)-4,5-dihydroxybenzoate, methyl 3,4-dihydroxy-5-phenylmethoxybenzoate, 3-Benzyloxy-4,5-dihydroxybenzoic acid methyl ester, Tryptophan-006, Bifendate-004, PUIWZZWMNAHWJG-UHFFFAOYSA-N, methyl 3-benzyloxy-4,5-dihydroxybenzoate, methyl 3-benzyloxy-4,5-dihydroxy-benzoate, Benzoic acid, 3,4-dihydroxy-5-(phenylmethoxy)-, methyl ester