CAS 79965-62-1 appears in our catalog under these names: 4-Methyl-3-nitroquinoline, 95%, 4–Methyl–3–nitroquinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 25g, 1g, 10g, 5g, 100mg.
4-methyl-3-nitroquinoline (CAS 79965-62-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 4-methyl-3-nitroquinoline. InChIKey: NDKYJOLMYSCMGQ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-methyl-3-nitroquinoline |
| InChIKey | NDKYJOLMYSCMGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC2=CC=CC=C12)[N+](=O)[O-] |
Computed by PubChem (NCBI)