Products 80-24-0

CAS 80-24-0 is the registry number for 1-(3-isopropylphenyl)-1-methylethyl Hydroperoxide. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(2-hydroperoxypropan-2-yl)-3-propan-2-ylbenzene (CAS 80-24-0) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 1-(2-hydroperoxypropan-2-yl)-3-propan-2-ylbenzene. InChIKey: PLLRMTWSFVDQEO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O2
Molecular weight194.27 g/mol
IUPAC name1-(2-hydroperoxypropan-2-yl)-3-propan-2-ylbenzene
InChIKeyPLLRMTWSFVDQEO-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=CC=C1)C(C)(C)OO

Computed by PubChem (NCBI)