CAS 800402-05-5 is the registry number for N–(6–chloro–3–iodopyridin–2–yl)pivalaMide. Offered by: GLPBio. Available pack sizes: 1g.
N-(6-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide (CAS 800402-05-5) is a chemical compound with the molecular formula C10H12ClIN2O and a molecular weight of 338.57 g/mol. IUPAC name: N-(6-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: SAQCDMGMWAACSN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClIN2O |
|---|---|
| Molecular weight | 338.57 g/mol |
| IUPAC name | N-(6-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | SAQCDMGMWAACSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC(=N1)Cl)I |
Computed by PubChem (NCBI)