CAS 898561-61-0 appears in our catalog under these names: N–(4–Chloro–3–iodo–pyridin–2–yl)–2,2–dimethyl–propionamide, Propanamide, N-(4-chloro-3-iodo-2-pyridinyl)-2,2-dimethyl-, 98+%, 98+%, N-(4-Chloro-3-iodopyridin-2-yl)pivalamide, 98+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
N-(4-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide (CAS 898561-61-0) is a chemical compound with the molecular formula C10H12ClIN2O and a molecular weight of 338.57 g/mol. IUPAC name: N-(4-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: IOIUSHNLFZWBBP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClIN2O |
|---|---|
| Molecular weight | 338.57 g/mol |
| IUPAC name | N-(4-chloro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | IOIUSHNLFZWBBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1I)Cl |
Computed by PubChem (NCBI)