Products 80126-52-9
CAS 80126-52-9 appears in our catalog under these names: D-3-Chlorophenylalanine, 97%, H–D–Phe(3–Cl)–OH, 3-Chloro-D-phenylalanine, 98%, 98%, 3-Chloro-D-phenylalanine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g.
(2R)-2-amino-3-(3-chlorophenyl)propanoic acid (CAS 80126-52-9) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (2R)-2-amino-3-(3-chlorophenyl)propanoic acid. InChIKey: JJDJLFDGCUYZMN-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-chlorophenyl)propanoic acid |
| InChIKey | JJDJLFDGCUYZMN-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)