CAS 80154-48-9 is the registry number for Cefuroxime Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7R)-7-(5-carboxypentanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 80154-48-9) is a chemical compound with the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. IUPAC name: (6R,7R)-7-(5-carboxypentanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: CSGFFYNMTALICU-ZWNOBZJWSA-N.
| Molecular formula | C14H18N2O6S |
|---|---|
| Molecular weight | 342.37 g/mol |
| IUPAC name | (6R,7R)-7-(5-carboxypentanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | CSGFFYNMTALICU-ZWNOBZJWSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCCCC(=O)O)SC1)C(=O)O |
Computed by PubChem (NCBI)