Products 897776-13-5

CAS 897776-13-5 is the registry number for 2-(6-(N,N-Diethylsulfamoyl)-3-oxo-2H-benzo[b][1,4]oxazin-4(3H)-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid (CAS 897776-13-5) is a chemical compound with the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. IUPAC name: 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid. InChIKey: JAXQZGZEEHLMSB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2O6S
Molecular weight342.37 g/mol
IUPAC name2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid
InChIKeyJAXQZGZEEHLMSB-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CC2=C(C=C1)OCC(=O)N2CC(=O)O

Computed by PubChem (NCBI)