CAS 897776-13-5 is the registry number for 2-(6-(N,N-Diethylsulfamoyl)-3-oxo-2H-benzo[b][1,4]oxazin-4(3H)-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid (CAS 897776-13-5) is a chemical compound with the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. IUPAC name: 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid. InChIKey: JAXQZGZEEHLMSB-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O6S |
|---|---|
| Molecular weight | 342.37 g/mol |
| IUPAC name | 2-[6-(diethylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| InChIKey | JAXQZGZEEHLMSB-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC2=C(C=C1)OCC(=O)N2CC(=O)O |
Computed by PubChem (NCBI)