CAS 80213-12-3 is the registry number for 1-Tosylpiperidin-4-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 250mg.
1-(4-methylphenyl)sulfonylpiperidin-4-ol (CAS 80213-12-3) is a chemical compound with the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidin-4-ol. InChIKey: YZUGYBUVPMOLGT-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidin-4-ol |
| InChIKey | YZUGYBUVPMOLGT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)O |
Computed by PubChem (NCBI)