Products 802266-18-8
CAS 802266-18-8 is the registry number for 6-Ethoxy-2-benzothiazolesulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-ethoxy-1,3-benzothiazole-2-sulfonic acid (CAS 802266-18-8) is a chemical compound with the molecular formula C9H9NO4S2 and a molecular weight of 259.3 g/mol. IUPAC name: 6-ethoxy-1,3-benzothiazole-2-sulfonic acid. InChIKey: WEHHXQZMAJEYNL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S2 |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 6-ethoxy-1,3-benzothiazole-2-sulfonic acid |
| InChIKey | WEHHXQZMAJEYNL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N=C(S2)S(=O)(=O)O |
Computed by PubChem (NCBI)