Products 849924-84-1
CAS 849924-84-1 is the registry number for 3,5-Bis(methylsulfonyl)benzonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
3,5-bis(methylsulfonyl)benzonitrile (CAS 849924-84-1) is a chemical compound with the molecular formula C9H9NO4S2 and a molecular weight of 259.3 g/mol. IUPAC name: 3,5-bis(methylsulfonyl)benzonitrile. InChIKey: RZFPKGRAQZGUPA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S2 |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 3,5-bis(methylsulfonyl)benzonitrile |
| InChIKey | RZFPKGRAQZGUPA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)C#N)S(=O)(=O)C |
Computed by PubChem (NCBI)